PNG  IHDRX cHRMz&u0`:pQ<bKGD pHYsodtIME MeqIDATxw]Wug^Qd˶ 6`!N:!@xI~)%7%@Bh&`lnjVF29gΨ4E$|>cɚ{gk= %,a KX%,a KX%,a KX%,a KX%,a KX%,a KX%, b` ǟzeאfp]<!SJmɤY޲ڿ,%c ~ع9VH.!Ͳz&QynֺTkRR.BLHi٪:l;@(!MԴ=žI,:o&N'Kù\vRmJ雵֫AWic H@" !: Cé||]k-Ha oݜ:y F())u]aG7*JV@J415p=sZH!=!DRʯvɱh~V\}v/GKY$n]"X"}t@ xS76^[bw4dsce)2dU0 CkMa-U5tvLƀ~mlMwfGE/-]7XAƟ`׮g ewxwC4\[~7@O-Q( a*XGƒ{ ՟}$_y3tĐƤatgvێi|K=uVyrŲlLӪuܿzwk$m87k( `múcE)"@rK( z4$D; 2kW=Xb$V[Ru819קR~qloѱDyįݎ*mxw]y5e4K@ЃI0A D@"BDk_)N\8͜9dz"fK0zɿvM /.:2O{ Nb=M=7>??Zuo32 DLD@D| &+֎C #B8ַ`bOb $D#ͮҪtx]%`ES`Ru[=¾!@Od37LJ0!OIR4m]GZRJu$‡c=%~s@6SKy?CeIh:[vR@Lh | (BhAMy=݃  G"'wzn޺~8ԽSh ~T*A:xR[ܹ?X[uKL_=fDȊ؂p0}7=D$Ekq!/t.*2ʼnDbŞ}DijYaȲ(""6HA;:LzxQ‘(SQQ}*PL*fc\s `/d'QXW, e`#kPGZuŞuO{{wm[&NBTiiI0bukcA9<4@SӊH*؎4U/'2U5.(9JuDfrޱtycU%j(:RUbArLֺN)udA':uGQN"-"Is.*+k@ `Ojs@yU/ H:l;@yyTn}_yw!VkRJ4P)~y#)r,D =ě"Q]ci'%HI4ZL0"MJy 8A{ aN<8D"1#IJi >XjX֔#@>-{vN!8tRݻ^)N_╗FJEk]CT՟ YP:_|H1@ CBk]yKYp|og?*dGvzنzӴzjֺNkC~AbZƷ`.H)=!QͷVTT(| u78y֮}|[8-Vjp%2JPk[}ԉaH8Wpqhwr:vWª<}l77_~{s۴V+RCģ%WRZ\AqHifɤL36: #F:p]Bq/z{0CU6ݳEv_^k7'>sq*+kH%a`0ԣisqにtү04gVgW΂iJiS'3w.w}l6MC2uԯ|>JF5`fV5m`Y**Db1FKNttu]4ccsQNnex/87+}xaUW9y>ͯ骵G{䩓Գ3+vU}~jJ.NFRD7<aJDB1#ҳgSb,+CS?/ VG J?|?,2#M9}B)MiE+G`-wo߫V`fio(}S^4e~V4bHOYb"b#E)dda:'?}׮4繏`{7Z"uny-?ǹ;0MKx{:_pÚmFמ:F " .LFQLG)Q8qN q¯¯3wOvxDb\. BKD9_NN &L:4D{mm o^tֽ:q!ƥ}K+<"m78N< ywsard5+вz~mnG)=}lYݧNj'QJS{S :UYS-952?&O-:W}(!6Mk4+>A>j+i|<<|;ر^߉=HE|V#F)Emm#}/"y GII웻Jі94+v뾧xu~5C95~ūH>c@덉pʃ1/4-A2G%7>m;–Y,cyyaln" ?ƻ!ʪ<{~h~i y.zZB̃/,雋SiC/JFMmBH&&FAbϓO^tubbb_hZ{_QZ-sύodFgO(6]TJA˯#`۶ɟ( %$&+V'~hiYy>922 Wp74Zkq+Ovn錄c>8~GqܲcWꂎz@"1A.}T)uiW4="jJ2W7mU/N0gcqܗOO}?9/wìXžΏ0 >֩(V^Rh32!Hj5`;O28؇2#ݕf3 ?sJd8NJ@7O0 b־?lldщ̡&|9C.8RTWwxWy46ah嘦mh٤&l zCy!PY?: CJyв]dm4ǜҐR޻RլhX{FƯanшQI@x' ao(kUUuxW_Ñ줮[w8 FRJ(8˼)_mQ _!RJhm=!cVmm ?sFOnll6Qk}alY}; "baӌ~M0w,Ggw2W:G/k2%R,_=u`WU R.9T"v,<\Ik޽/2110Ӿxc0gyC&Ny޽JҢrV6N ``یeA16"J³+Rj*;BϜkZPJaÍ<Jyw:NP8/D$ 011z֊Ⱳ3ι֘k1V_"h!JPIΣ'ɜ* aEAd:ݺ>y<}Lp&PlRfTb1]o .2EW\ͮ]38؋rTJsǏP@芎sF\> P^+dYJLbJ C-xϐn> ι$nj,;Ǖa FU *择|h ~izť3ᤓ`K'-f tL7JK+vf2)V'-sFuB4i+m+@My=O҈0"|Yxoj,3]:cо3 $#uŘ%Y"y죯LebqtҢVzq¼X)~>4L׶m~[1_k?kxֺQ`\ |ٛY4Ѯr!)N9{56(iNq}O()Em]=F&u?$HypWUeB\k]JɩSع9 Zqg4ZĊo oMcjZBU]B\TUd34ݝ~:7ڶSUsB0Z3srx 7`:5xcx !qZA!;%͚7&P H<WL!džOb5kF)xor^aujƍ7 Ǡ8/p^(L>ὴ-B,{ۇWzֺ^k]3\EE@7>lYBȝR.oHnXO/}sB|.i@ɥDB4tcm,@ӣgdtJ!lH$_vN166L__'Z)y&kH;:,Y7=J 9cG) V\hjiE;gya~%ks_nC~Er er)muuMg2;֫R)Md) ,¶ 2-wr#F7<-BBn~_(o=KO㭇[Xv eN_SMgSҐ BS헃D%g_N:/pe -wkG*9yYSZS.9cREL !k}<4_Xs#FmҶ:7R$i,fi!~' # !6/S6y@kZkZcX)%5V4P]VGYq%H1!;e1MV<!ϐHO021Dp= HMs~~a)ަu7G^];git!Frl]H/L$=AeUvZE4P\.,xi {-~p?2b#amXAHq)MWǾI_r`S Hz&|{ +ʖ_= (YS(_g0a03M`I&'9vl?MM+m~}*xT۲(fY*V4x@29s{DaY"toGNTO+xCAO~4Ϳ;p`Ѫ:>Ҵ7K 3}+0 387x\)a"/E>qpWB=1 ¨"MP(\xp߫́A3+J] n[ʼnӼaTbZUWb={~2ooKױӰp(CS\S筐R*JغV&&"FA}J>G֐p1ٸbk7 ŘH$JoN <8s^yk_[;gy-;߉DV{c B yce% aJhDȶ 2IdйIB/^n0tNtџdcKj4϶v~- CBcgqx9= PJ) dMsjpYB] GD4RDWX +h{y`,3ꊕ$`zj*N^TP4L:Iz9~6s) Ga:?y*J~?OrMwP\](21sZUD ?ܟQ5Q%ggW6QdO+\@ ̪X'GxN @'4=ˋ+*VwN ne_|(/BDfj5(Dq<*tNt1х!MV.C0 32b#?n0pzj#!38}޴o1KovCJ`8ŗ_"]] rDUy޲@ Ȗ-;xџ'^Y`zEd?0„ DAL18IS]VGq\4o !swV7ˣι%4FѮ~}6)OgS[~Q vcYbL!wG3 7띸*E Pql8=jT\꘿I(z<[6OrR8ºC~ډ]=rNl[g|v TMTղb-o}OrP^Q]<98S¤!k)G(Vkwyqyr޽Nv`N/e p/~NAOk \I:G6]4+K;j$R:Mi #*[AȚT,ʰ,;N{HZTGMoּy) ]%dHء9Պ䠬|<45,\=[bƟ8QXeB3- &dҩ^{>/86bXmZ]]yޚN[(WAHL$YAgDKp=5GHjU&99v簪C0vygln*P)9^͞}lMuiH!̍#DoRBn9l@ xA/_v=ȺT{7Yt2N"4!YN`ae >Q<XMydEB`VU}u]嫇.%e^ánE87Mu\t`cP=AD/G)sI"@MP;)]%fH9'FNsj1pVhY&9=0pfuJ&gޤx+k:!r˭wkl03׼Ku C &ѓYt{.O.zҏ z}/tf_wEp2gvX)GN#I ݭ߽v/ .& и(ZF{e"=V!{zW`, ]+LGz"(UJp|j( #V4, 8B 0 9OkRrlɱl94)'VH9=9W|>PS['G(*I1==C<5"Pg+x'K5EMd؞Af8lG ?D FtoB[je?{k3zQ vZ;%Ɠ,]E>KZ+T/ EJxOZ1i #T<@ I}q9/t'zi(EMqw`mYkU6;[t4DPeckeM;H}_g pMww}k6#H㶏+b8雡Sxp)&C $@'b,fPߑt$RbJ'vznuS ~8='72_`{q纶|Q)Xk}cPz9p7O:'|G~8wx(a 0QCko|0ASD>Ip=4Q, d|F8RcU"/KM opKle M3#i0c%<7׿p&pZq[TR"BpqauIp$ 8~Ĩ!8Սx\ւdT>>Z40ks7 z2IQ}ItԀ<-%S⍤};zIb$I 5K}Q͙D8UguWE$Jh )cu4N tZl+[]M4k8֦Zeq֮M7uIqG 1==tLtR,ƜSrHYt&QP윯Lg' I,3@P'}'R˪e/%-Auv·ñ\> vDJzlӾNv5:|K/Jb6KI9)Zh*ZAi`?S {aiVDԲuy5W7pWeQJk֤#5&V<̺@/GH?^τZL|IJNvI:'P=Ϛt"¨=cud S Q.Ki0 !cJy;LJR;G{BJy޺[^8fK6)=yʊ+(k|&xQ2`L?Ȓ2@Mf 0C`6-%pKpm')c$׻K5[J*U[/#hH!6acB JA _|uMvDyk y)6OPYjœ50VT K}cǻP[ $:]4MEA.y)|B)cf-A?(e|lɉ#P9V)[9t.EiQPDѠ3ϴ;E:+Օ t ȥ~|_N2,ZJLt4! %ա]u {+=p.GhNcŞQI?Nd'yeh n7zi1DB)1S | S#ًZs2|Ɛy$F SxeX{7Vl.Src3E℃Q>b6G ўYCmtկ~=K0f(=LrAS GN'ɹ9<\!a`)֕y[uՍ[09` 9 +57ts6}b4{oqd+J5fa/,97J#6yν99mRWxJyѡyu_TJc`~W>l^q#Ts#2"nD1%fS)FU w{ܯ R{ ˎ󅃏џDsZSQS;LV;7 Od1&1n$ N /.q3~eNɪ]E#oM~}v֯FڦwyZ=<<>Xo稯lfMFV6p02|*=tV!c~]fa5Y^Q_WN|Vs 0ҘދU97OI'N2'8N֭fgg-}V%y]U4 峧p*91#9U kCac_AFңĪy뚇Y_AiuYyTTYЗ-(!JFLt›17uTozc. S;7A&&<ԋ5y;Ro+:' *eYJkWR[@F %SHWP 72k4 qLd'J "zB6{AC0ƁA6U.'F3:Ȅ(9ΜL;D]m8ڥ9}dU "v!;*13Rg^fJyShyy5auA?ɩGHRjo^]׽S)Fm\toy 4WQS@mE#%5ʈfFYDX ~D5Ϡ9tE9So_aU4?Ѽm%&c{n>.KW1Tlb}:j uGi(JgcYj0qn+>) %\!4{LaJso d||u//P_y7iRJ߬nHOy) l+@$($VFIQ9%EeKʈU. ia&FY̒mZ=)+qqoQn >L!qCiDB;Y<%} OgBxB!ØuG)WG9y(Ą{_yesuZmZZey'Wg#C~1Cev@0D $a@˲(.._GimA:uyw֬%;@!JkQVM_Ow:P.s\)ot- ˹"`B,e CRtaEUP<0'}r3[>?G8xU~Nqu;Wm8\RIkբ^5@k+5(By'L&'gBJ3ݶ!/㮻w҅ yqPWUg<e"Qy*167΃sJ\oz]T*UQ<\FԎ`HaNmڜ6DysCask8wP8y9``GJ9lF\G g's Nn͵MLN֪u$| /|7=]O)6s !ĴAKh]q_ap $HH'\1jB^s\|- W1:=6lJBqjY^LsPk""`]w)󭃈,(HC ?䔨Y$Sʣ{4Z+0NvQkhol6C.婧/u]FwiVjZka&%6\F*Ny#8O,22+|Db~d ~Çwc N:FuuCe&oZ(l;@ee-+Wn`44AMK➝2BRՈt7g*1gph9N) *"TF*R(#'88pm=}X]u[i7bEc|\~EMn}P瘊J)K.0i1M6=7'_\kaZ(Th{K*GJyytw"IO-PWJk)..axӝ47"89Cc7ĐBiZx 7m!fy|ϿF9CbȩV 9V-՛^pV̌ɄS#Bv4-@]Vxt-Z, &ֺ*diؠ2^VXbs֔Ìl.jQ]Y[47gj=幽ex)A0ip׳ W2[ᎇhuE^~q흙L} #-b۸oFJ_QP3r6jr+"nfzRJTUqoaۍ /$d8Mx'ݓ= OՃ| )$2mcM*cЙj}f };n YG w0Ia!1Q.oYfr]DyISaP}"dIӗթO67jqR ҊƐƈaɤGG|h;t]䗖oSv|iZqX)oalv;۩meEJ\!8=$4QU4Xo&VEĊ YS^E#d,yX_> ۘ-e\ "Wa6uLĜZi`aD9.% w~mB(02G[6y.773a7 /=o7D)$Z 66 $bY^\CuP. (x'"J60׿Y:Oi;F{w佩b+\Yi`TDWa~|VH)8q/=9!g߆2Y)?ND)%?Ǐ`k/sn:;O299yB=a[Ng 3˲N}vLNy;*?x?~L&=xyӴ~}q{qE*IQ^^ͧvü{Huu=R|>JyUlZV, B~/YF!Y\u_ݼF{_C)LD]m {H 0ihhadd nUkf3oٺCvE\)QJi+֥@tDJkB$1!Đr0XQ|q?d2) Ӣ_}qv-< FŊ߫%roppVBwü~JidY4:}L6M7f٬F "?71<2#?Jyy4뷢<_a7_=Q E=S1И/9{+93֮E{ǂw{))?maÆm(uLE#lïZ  ~d];+]h j?!|$F}*"4(v'8s<ŏUkm7^7no1w2ؗ}TrͿEk>p'8OB7d7R(A 9.*Mi^ͳ; eeUwS+C)uO@ =Sy]` }l8^ZzRXj[^iUɺ$tj))<sbDJfg=Pk_{xaKo1:-uyG0M ԃ\0Lvuy'ȱc2Ji AdyVgVh!{]/&}}ċJ#%d !+87<;qN޼Nفl|1N:8ya  8}k¾+-$4FiZYÔXk*I&'@iI99)HSh4+2G:tGhS^繿 Kتm0 вDk}֚+QT4;sC}rՅE,8CX-e~>G&'9xpW,%Fh,Ry56Y–hW-(v_,? ; qrBk4-V7HQ;ˇ^Gv1JVV%,ik;D_W!))+BoS4QsTM;gt+ndS-~:11Sgv!0qRVh!"Ȋ(̦Yl.]PQWgٳE'`%W1{ndΗBk|Ž7ʒR~,lnoa&:ü$ 3<a[CBݮwt"o\ePJ=Hz"_c^Z.#ˆ*x z̝grY]tdkP*:97YľXyBkD4N.C_[;F9`8& !AMO c `@BA& Ost\-\NX+Xp < !bj3C&QL+*&kAQ=04}cC!9~820G'PC9xa!w&bo_1 Sw"ܱ V )Yl3+ס2KoXOx]"`^WOy :3GO0g;%Yv㐫(R/r (s } u B &FeYZh0y> =2<Ϟc/ -u= c&׭,.0"g"7 6T!vl#sc>{u/Oh Bᾈ)۴74]x7 gMӒ"d]U)}" v4co[ ɡs 5Gg=XR14?5A}D "b{0$L .\4y{_fe:kVS\\O]c^W52LSBDM! C3Dhr̦RtArx4&agaN3Cf<Ԉp4~ B'"1@.b_/xQ} _߃҉/gٓ2Qkqp0շpZ2fԫYz< 4L.Cyυι1t@鎫Fe sYfsF}^ V}N<_`p)alٶ "(XEAVZ<)2},:Ir*#m_YӼ R%a||EƼIJ,,+f"96r/}0jE/)s)cjW#w'Sʯ5<66lj$a~3Kʛy 2:cZ:Yh))+a߭K::N,Q F'qB]={.]h85C9cr=}*rk?vwV렵ٸW Rs%}rNAkDv|uFLBkWY YkX מ|)1!$#3%y?pF<@<Rr0}: }\J [5FRxY<9"SQdE(Q*Qʻ)q1E0B_O24[U'],lOb ]~WjHޏTQ5Syu wq)xnw8~)c 쫬gٲߠ H% k5dƝk> kEj,0% b"vi2Wس_CuK)K{n|>t{P1򨾜j>'kEkƗBg*H%'_aY6Bn!TL&ɌOb{c`'d^{t\i^[uɐ[}q0lM˕G:‚4kb祔c^:?bpg… +37stH:0}en6x˟%/<]BL&* 5&fK9Mq)/iyqtA%kUe[ڛKN]Ě^,"`/ s[EQQm?|XJ߅92m]G.E΃ח U*Cn.j_)Tѧj̿30ڇ!A0=͜ar I3$C^-9#|pk!)?7.x9 @OO;WƝZBFU keZ75F6Tc6"ZȚs2y/1 ʵ:u4xa`C>6Rb/Yм)^=+~uRd`/|_8xbB0?Ft||Z\##|K 0>>zxv8۴吅q 8ĥ)"6>~\8:qM}#͚'ĉ#p\׶ l#bA?)|g g9|8jP(cr,BwV (WliVxxᡁ@0Okn;ɥh$_ckCgriv}>=wGzβ KkBɛ[˪ !J)h&k2%07δt}!d<9;I&0wV/ v 0<H}L&8ob%Hi|޶o&h1L|u֦y~󛱢8fٲUsւ)0oiFx2}X[zVYr_;N(w]_4B@OanC?gĦx>мgx>ΛToZoOMp>40>V Oy V9iq!4 LN,ˢu{jsz]|"R޻&'ƚ{53ўFu(<٪9:΋]B;)B>1::8;~)Yt|0(pw2N%&X,URBK)3\zz&}ax4;ǟ(tLNg{N|Ǽ\G#C9g$^\}p?556]/RP.90 k,U8/u776s ʪ_01چ|\N 0VV*3H鴃J7iI!wG_^ypl}r*jɤSR 5QN@ iZ#1ٰy;_\3\BQQ x:WJv츟ٯ$"@6 S#qe딇(/P( Dy~TOϻ<4:-+F`0||;Xl-"uw$Цi󼕝mKʩorz"mϺ$F:~E'ҐvD\y?Rr8_He@ e~O,T.(ފR*cY^m|cVR[8 JҡSm!ΆԨb)RHG{?MpqrmN>߶Y)\p,d#xۆWY*,l6]v0h15M˙MS8+EdI='LBJIH7_9{Caз*Lq,dt >+~ّeʏ?xԕ4bBAŚjﵫ!'\Ը$WNvKO}ӽmSşذqsOy?\[,d@'73'j%kOe`1.g2"e =YIzS2|zŐƄa\U,dP;jhhhaxǶ?КZ՚.q SE+XrbOu%\GتX(H,N^~]JyEZQKceTQ]VGYqnah;y$cQahT&QPZ*iZ8UQQM.qo/T\7X"u?Mttl2Xq(IoW{R^ ux*SYJ! 4S.Jy~ BROS[V|žKNɛP(L6V^|cR7i7nZW1Fd@ Ara{詑|(T*dN]Ko?s=@ |_EvF]׍kR)eBJc" MUUbY6`~V޴dJKß&~'d3i WWWWWW
Current Directory: /opt/alt/alt-nodejs18/root/usr/include/node
Viewing File: /opt/alt/alt-nodejs18/root/usr/include/node/v8-script.h
// Copyright 2021 the V8 project authors. All rights reserved. // Use of this source code is governed by a BSD-style license that can be // found in the LICENSE file. #ifndef INCLUDE_V8_SCRIPT_H_ #define INCLUDE_V8_SCRIPT_H_ #include <stddef.h> #include <stdint.h> #include <memory> #include <vector> #include "v8-data.h" // NOLINT(build/include_directory) #include "v8-local-handle.h" // NOLINT(build/include_directory) #include "v8-maybe.h" // NOLINT(build/include_directory) #include "v8-message.h" // NOLINT(build/include_directory) #include "v8config.h" // NOLINT(build/include_directory) namespace v8 { class Function; class Object; class PrimitiveArray; class Script; namespace internal { class BackgroundDeserializeTask; struct ScriptStreamingData; } // namespace internal /** * A container type that holds relevant metadata for module loading. * * This is passed back to the embedder as part of * HostImportModuleDynamicallyCallback for module loading. */ class V8_EXPORT ScriptOrModule { public: /** * The name that was passed by the embedder as ResourceName to the * ScriptOrigin. This can be either a v8::String or v8::Undefined. */ Local<Value> GetResourceName(); /** * The options that were passed by the embedder as HostDefinedOptions to * the ScriptOrigin. */ V8_DEPRECATED("Use HostDefinedOptions") Local<PrimitiveArray> GetHostDefinedOptions(); Local<Data> HostDefinedOptions(); }; /** * A compiled JavaScript script, not yet tied to a Context. */ class V8_EXPORT UnboundScript { public: /** * Binds the script to the currently entered context. */ Local<Script> BindToCurrentContext(); int GetId() const; Local<Value> GetScriptName(); /** * Data read from magic sourceURL comments. */ Local<Value> GetSourceURL(); /** * Data read from magic sourceMappingURL comments. */ Local<Value> GetSourceMappingURL(); /** * Returns zero based line number of the code_pos location in the script. * -1 will be returned if no information available. */ int GetLineNumber(int code_pos); static const int kNoScriptId = 0; }; /** * A compiled JavaScript module, not yet tied to a Context. */ class V8_EXPORT UnboundModuleScript : public Data { // Only used as a container for code caching. }; /** * A location in JavaScript source. */ class V8_EXPORT Location { public: int GetLineNumber() { return line_number_; } int GetColumnNumber() { return column_number_; } Location(int line_number, int column_number) : line_number_(line_number), column_number_(column_number) {} private: int line_number_; int column_number_; }; class V8_EXPORT ModuleRequest : public Data { public: /** * Returns the module specifier for this ModuleRequest. */ Local<String> GetSpecifier() const; /** * Returns the source code offset of this module request. * Use Module::SourceOffsetToLocation to convert this to line/column numbers. */ int GetSourceOffset() const; /** * Contains the import assertions for this request in the form: * [key1, value1, source_offset1, key2, value2, source_offset2, ...]. * The keys and values are of type v8::String, and the source offsets are of * type Int32. Use Module::SourceOffsetToLocation to convert the source * offsets to Locations with line/column numbers. * * All assertions present in the module request will be supplied in this * list, regardless of whether they are supported by the host. Per * https://tc39.es/proposal-import-attributes/#sec-hostgetsupportedimportattributes, * hosts are expected to throw for assertions that they do not support (as * opposed to, for example, ignoring them). */ Local<FixedArray> GetImportAssertions() const; V8_INLINE static ModuleRequest* Cast(Data* data); private: static void CheckCast(Data* obj); }; /** * A compiled JavaScript module. */ class V8_EXPORT Module : public Data { public: /** * The different states a module can be in. * * This corresponds to the states used in ECMAScript except that "evaluated" * is split into kEvaluated and kErrored, indicating success and failure, * respectively. */ enum Status { kUninstantiated, kInstantiating, kInstantiated, kEvaluating, kEvaluated, kErrored }; /** * Returns the module's current status. */ Status GetStatus() const; /** * For a module in kErrored status, this returns the corresponding exception. */ Local<Value> GetException() const; /** * Returns the ModuleRequests for this module. */ Local<FixedArray> GetModuleRequests() const; /** * For the given source text offset in this module, returns the corresponding * Location with line and column numbers. */ Location SourceOffsetToLocation(int offset) const; /** * Returns the identity hash for this object. */ int GetIdentityHash() const; using ResolveModuleCallback = MaybeLocal<Module> (*)( Local<Context> context, Local<String> specifier, Local<FixedArray> import_assertions, Local<Module> referrer); /** * Instantiates the module and its dependencies. * * Returns an empty Maybe<bool> if an exception occurred during * instantiation. (In the case where the callback throws an exception, that * exception is propagated.) */ V8_WARN_UNUSED_RESULT Maybe<bool> InstantiateModule( Local<Context> context, ResolveModuleCallback callback); /** * Evaluates the module and its dependencies. * * If status is kInstantiated, run the module's code and return a Promise * object. On success, set status to kEvaluated and resolve the Promise with * the completion value; on failure, set status to kErrored and reject the * Promise with the error. * * If IsGraphAsync() is false, the returned Promise is settled. */ V8_WARN_UNUSED_RESULT MaybeLocal<Value> Evaluate(Local<Context> context); /** * Returns the namespace object of this module. * * The module's status must be at least kInstantiated. */ Local<Value> GetModuleNamespace(); /** * Returns the corresponding context-unbound module script. * * The module must be unevaluated, i.e. its status must not be kEvaluating, * kEvaluated or kErrored. */ Local<UnboundModuleScript> GetUnboundModuleScript(); /** * Returns the underlying script's id. * * The module must be a SourceTextModule and must not have a kErrored status. */ int ScriptId() const; /** * Returns whether this module or any of its requested modules is async, * i.e. contains top-level await. * * The module's status must be at least kInstantiated. */ bool IsGraphAsync() const; /** * Returns whether the module is a SourceTextModule. */ bool IsSourceTextModule() const; /** * Returns whether the module is a SyntheticModule. */ bool IsSyntheticModule() const; /* * Callback defined in the embedder. This is responsible for setting * the module's exported values with calls to SetSyntheticModuleExport(). * The callback must return a resolved Promise to indicate success (where no * exception was thrown) and return an empy MaybeLocal to indicate falure * (where an exception was thrown). */ using SyntheticModuleEvaluationSteps = MaybeLocal<Value> (*)(Local<Context> context, Local<Module> module); /** * Creates a new SyntheticModule with the specified export names, where * evaluation_steps will be executed upon module evaluation. * export_names must not contain duplicates. * module_name is used solely for logging/debugging and doesn't affect module * behavior. */ static Local<Module> CreateSyntheticModule( Isolate* isolate, Local<String> module_name, const std::vector<Local<String>>& export_names, SyntheticModuleEvaluationSteps evaluation_steps); /** * Set this module's exported value for the name export_name to the specified * export_value. This method must be called only on Modules created via * CreateSyntheticModule. An error will be thrown if export_name is not one * of the export_names that were passed in that CreateSyntheticModule call. * Returns Just(true) on success, Nothing<bool>() if an error was thrown. */ V8_WARN_UNUSED_RESULT Maybe<bool> SetSyntheticModuleExport( Isolate* isolate, Local<String> export_name, Local<Value> export_value); V8_INLINE static Module* Cast(Data* data); private: static void CheckCast(Data* obj); }; /** * A compiled JavaScript script, tied to a Context which was active when the * script was compiled. */ class V8_EXPORT Script { public: /** * A shorthand for ScriptCompiler::Compile(). */ static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile( Local<Context> context, Local<String> source, ScriptOrigin* origin = nullptr); /** * Runs the script returning the resulting value. It will be run in the * context in which it was created (ScriptCompiler::CompileBound or * UnboundScript::BindToCurrentContext()). */ V8_WARN_UNUSED_RESULT MaybeLocal<Value> Run(Local<Context> context); V8_WARN_UNUSED_RESULT MaybeLocal<Value> Run(Local<Context> context, Local<Data> host_defined_options); /** * Returns the corresponding context-unbound script. */ Local<UnboundScript> GetUnboundScript(); /** * The name that was passed by the embedder as ResourceName to the * ScriptOrigin. This can be either a v8::String or v8::Undefined. */ Local<Value> GetResourceName(); }; enum class ScriptType { kClassic, kModule }; /** * For compiling scripts. */ class V8_EXPORT ScriptCompiler { public: class ConsumeCodeCacheTask; /** * Compilation data that the embedder can cache and pass back to speed up * future compilations. The data is produced if the CompilerOptions passed to * the compilation functions in ScriptCompiler contains produce_data_to_cache * = true. The data to cache can then can be retrieved from * UnboundScript. */ struct V8_EXPORT CachedData { enum BufferPolicy { BufferNotOwned, BufferOwned }; CachedData() : data(nullptr), length(0), rejected(false), buffer_policy(BufferNotOwned) {} // If buffer_policy is BufferNotOwned, the caller keeps the ownership of // data and guarantees that it stays alive until the CachedData object is // destroyed. If the policy is BufferOwned, the given data will be deleted // (with delete[]) when the CachedData object is destroyed. CachedData(const uint8_t* data, int length, BufferPolicy buffer_policy = BufferNotOwned); ~CachedData(); // TODO(marja): Async compilation; add constructors which take a callback // which will be called when V8 no longer needs the data. const uint8_t* data; int length; bool rejected; BufferPolicy buffer_policy; // Prevent copying. CachedData(const CachedData&) = delete; CachedData& operator=(const CachedData&) = delete; }; /** * Source code which can be then compiled to a UnboundScript or Script. */ class Source { public: // Source takes ownership of both CachedData and CodeCacheConsumeTask. // The caller *must* ensure that the cached data is from a trusted source. V8_INLINE Source(Local<String> source_string, const ScriptOrigin& origin, CachedData* cached_data = nullptr, ConsumeCodeCacheTask* consume_cache_task = nullptr); // Source takes ownership of both CachedData and CodeCacheConsumeTask. V8_INLINE explicit Source( Local<String> source_string, CachedData* cached_data = nullptr, ConsumeCodeCacheTask* consume_cache_task = nullptr); V8_INLINE ~Source() = default; // Ownership of the CachedData or its buffers is *not* transferred to the // caller. The CachedData object is alive as long as the Source object is // alive. V8_INLINE const CachedData* GetCachedData() const; V8_INLINE const ScriptOriginOptions& GetResourceOptions() const; private: friend class ScriptCompiler; Local<String> source_string; // Origin information Local<Value> resource_name; int resource_line_offset; int resource_column_offset; ScriptOriginOptions resource_options; Local<Value> source_map_url; Local<Data> host_defined_options; // Cached data from previous compilation (if a kConsume*Cache flag is // set), or hold newly generated cache data (kProduce*Cache flags) are // set when calling a compile method. std::unique_ptr<CachedData> cached_data; std::unique_ptr<ConsumeCodeCacheTask> consume_cache_task; }; /** * For streaming incomplete script data to V8. The embedder should implement a * subclass of this class. */ class V8_EXPORT ExternalSourceStream { public: virtual ~ExternalSourceStream() = default; /** * V8 calls this to request the next chunk of data from the embedder. This * function will be called on a background thread, so it's OK to block and * wait for the data, if the embedder doesn't have data yet. Returns the * length of the data returned. When the data ends, GetMoreData should * return 0. Caller takes ownership of the data. * * When streaming UTF-8 data, V8 handles multi-byte characters split between * two data chunks, but doesn't handle multi-byte characters split between * more than two data chunks. The embedder can avoid this problem by always * returning at least 2 bytes of data. * * When streaming UTF-16 data, V8 does not handle characters split between * two data chunks. The embedder has to make sure that chunks have an even * length. * * If the embedder wants to cancel the streaming, they should make the next * GetMoreData call return 0. V8 will interpret it as end of data (and most * probably, parsing will fail). The streaming task will return as soon as * V8 has parsed the data it received so far. */ virtual size_t GetMoreData(const uint8_t** src) = 0; }; /** * Source code which can be streamed into V8 in pieces. It will be parsed * while streaming and compiled after parsing has completed. StreamedSource * must be kept alive while the streaming task is run (see ScriptStreamingTask * below). */ class V8_EXPORT StreamedSource { public: enum Encoding { ONE_BYTE, TWO_BYTE, UTF8, WINDOWS_1252 }; StreamedSource(std::unique_ptr<ExternalSourceStream> source_stream, Encoding encoding); ~StreamedSource(); internal::ScriptStreamingData* impl() const { return impl_.get(); } // Prevent copying. StreamedSource(const StreamedSource&) = delete; StreamedSource& operator=(const StreamedSource&) = delete; private: std::unique_ptr<internal::ScriptStreamingData> impl_; }; /** * A streaming task which the embedder must run on a background thread to * stream scripts into V8. Returned by ScriptCompiler::StartStreaming. */ class V8_EXPORT ScriptStreamingTask final { public: void Run(); private: friend class ScriptCompiler; explicit ScriptStreamingTask(internal::ScriptStreamingData* data) : data_(data) {} internal::ScriptStreamingData* data_; }; /** * A task which the embedder must run on a background thread to * consume a V8 code cache. Returned by * ScriptCompiler::StarConsumingCodeCache. */ class V8_EXPORT ConsumeCodeCacheTask final { public: ~ConsumeCodeCacheTask(); void Run(); private: friend class ScriptCompiler; explicit ConsumeCodeCacheTask( std::unique_ptr<internal::BackgroundDeserializeTask> impl); std::unique_ptr<internal::BackgroundDeserializeTask> impl_; }; enum CompileOptions { kNoCompileOptions = 0, kConsumeCodeCache, kEagerCompile }; /** * The reason for which we are not requesting or providing a code cache. */ enum NoCacheReason { kNoCacheNoReason = 0, kNoCacheBecauseCachingDisabled, kNoCacheBecauseNoResource, kNoCacheBecauseInlineScript, kNoCacheBecauseModule, kNoCacheBecauseStreamingSource, kNoCacheBecauseInspector, kNoCacheBecauseScriptTooSmall, kNoCacheBecauseCacheTooCold, kNoCacheBecauseV8Extension, kNoCacheBecauseExtensionModule, kNoCacheBecausePacScript, kNoCacheBecauseInDocumentWrite, kNoCacheBecauseResourceWithNoCacheHandler, kNoCacheBecauseDeferredProduceCodeCache }; /** * Compiles the specified script (context-independent). * Cached data as part of the source object can be optionally produced to be * consumed later to speed up compilation of identical source scripts. * * Note that when producing cached data, the source must point to NULL for * cached data. When consuming cached data, the cached data must have been * produced by the same version of V8, and the embedder needs to ensure the * cached data is the correct one for the given script. * * \param source Script source code. * \return Compiled script object (context independent; for running it must be * bound to a context). */ static V8_WARN_UNUSED_RESULT MaybeLocal<UnboundScript> CompileUnboundScript( Isolate* isolate, Source* source, CompileOptions options = kNoCompileOptions, NoCacheReason no_cache_reason = kNoCacheNoReason); /** * Compiles the specified script (bound to current context). * * \param source Script source code. * \param pre_data Pre-parsing data, as obtained by ScriptData::PreCompile() * using pre_data speeds compilation if it's done multiple times. * Owned by caller, no references are kept when this function returns. * \return Compiled script object, bound to the context that was active * when this function was called. When run it will always use this * context. */ static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile( Local<Context> context, Source* source, CompileOptions options = kNoCompileOptions, NoCacheReason no_cache_reason = kNoCacheNoReason); /** * Returns a task which streams script data into V8, or NULL if the script * cannot be streamed. The user is responsible for running the task on a * background thread and deleting it. When ran, the task starts parsing the * script, and it will request data from the StreamedSource as needed. When * ScriptStreamingTask::Run exits, all data has been streamed and the script * can be compiled (see Compile below). * * This API allows to start the streaming with as little data as possible, and * the remaining data (for example, the ScriptOrigin) is passed to Compile. */ static ScriptStreamingTask* StartStreaming( Isolate* isolate, StreamedSource* source, ScriptType type = ScriptType::kClassic); static ConsumeCodeCacheTask* StartConsumingCodeCache( Isolate* isolate, std::unique_ptr<CachedData> source); /** * Compiles a streamed script (bound to current context). * * This can only be called after the streaming has finished * (ScriptStreamingTask has been run). V8 doesn't construct the source string * during streaming, so the embedder needs to pass the full source here. */ static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile( Local<Context> context, StreamedSource* source, Local<String> full_source_string, const ScriptOrigin& origin); /** * Return a version tag for CachedData for the current V8 version & flags. * * This value is meant only for determining whether a previously generated * CachedData instance is still valid; the tag has no other meaing. * * Background: The data carried by CachedData may depend on the exact * V8 version number or current compiler flags. This means that when * persisting CachedData, the embedder must take care to not pass in * data from another V8 version, or the same version with different * features enabled. * * The easiest way to do so is to clear the embedder's cache on any * such change. * * Alternatively, this tag can be stored alongside the cached data and * compared when it is being used. */ static uint32_t CachedDataVersionTag(); /** * Compile an ES module, returning a Module that encapsulates * the compiled code. * * Corresponds to the ParseModule abstract operation in the * ECMAScript specification. */ static V8_WARN_UNUSED_RESULT MaybeLocal<Module> CompileModule( Isolate* isolate, Source* source, CompileOptions options = kNoCompileOptions, NoCacheReason no_cache_reason = kNoCacheNoReason); /** * Compiles a streamed module script. * * This can only be called after the streaming has finished * (ScriptStreamingTask has been run). V8 doesn't construct the source string * during streaming, so the embedder needs to pass the full source here. */ static V8_WARN_UNUSED_RESULT MaybeLocal<Module> CompileModule( Local<Context> context, StreamedSource* v8_source, Local<String> full_source_string, const ScriptOrigin& origin); /** * Compile a function for a given context. This is equivalent to running * * with (obj) { * return function(args) { ... } * } * * It is possible to specify multiple context extensions (obj in the above * example). */ static V8_WARN_UNUSED_RESULT MaybeLocal<Function> CompileFunctionInContext( Local<Context> context, Source* source, size_t arguments_count, Local<String> arguments[], size_t context_extension_count, Local<Object> context_extensions[], CompileOptions options = kNoCompileOptions, NoCacheReason no_cache_reason = kNoCacheNoReason, Local<ScriptOrModule>* script_or_module_out = nullptr); static V8_WARN_UNUSED_RESULT MaybeLocal<Function> CompileFunction( Local<Context> context, Source* source, size_t arguments_count = 0, Local<String> arguments[] = nullptr, size_t context_extension_count = 0, Local<Object> context_extensions[] = nullptr, CompileOptions options = kNoCompileOptions, NoCacheReason no_cache_reason = kNoCacheNoReason); /** * Creates and returns code cache for the specified unbound_script. * This will return nullptr if the script cannot be serialized. The * CachedData returned by this function should be owned by the caller. */ static CachedData* CreateCodeCache(Local<UnboundScript> unbound_script); /** * Creates and returns code cache for the specified unbound_module_script. * This will return nullptr if the script cannot be serialized. The * CachedData returned by this function should be owned by the caller. */ static CachedData* CreateCodeCache( Local<UnboundModuleScript> unbound_module_script); /** * Creates and returns code cache for the specified function that was * previously produced by CompileFunction. * This will return nullptr if the script cannot be serialized. The * CachedData returned by this function should be owned by the caller. */ static CachedData* CreateCodeCacheForFunction(Local<Function> function); private: static V8_WARN_UNUSED_RESULT MaybeLocal<UnboundScript> CompileUnboundInternal( Isolate* isolate, Source* source, CompileOptions options, NoCacheReason no_cache_reason); static V8_WARN_UNUSED_RESULT MaybeLocal<Function> CompileFunctionInternal( Local<Context> context, Source* source, size_t arguments_count, Local<String> arguments[], size_t context_extension_count, Local<Object> context_extensions[], CompileOptions options, NoCacheReason no_cache_reason, Local<ScriptOrModule>* script_or_module_out); }; ScriptCompiler::Source::Source(Local<String> string, const ScriptOrigin& origin, CachedData* data, ConsumeCodeCacheTask* consume_cache_task) : source_string(string), resource_name(origin.ResourceName()), resource_line_offset(origin.LineOffset()), resource_column_offset(origin.ColumnOffset()), resource_options(origin.Options()), source_map_url(origin.SourceMapUrl()), host_defined_options(origin.GetHostDefinedOptions()), cached_data(data), consume_cache_task(consume_cache_task) {} ScriptCompiler::Source::Source(Local<String> string, CachedData* data, ConsumeCodeCacheTask* consume_cache_task) : source_string(string), cached_data(data), consume_cache_task(consume_cache_task) {} const ScriptCompiler::CachedData* ScriptCompiler::Source::GetCachedData() const { return cached_data.get(); } const ScriptOriginOptions& ScriptCompiler::Source::GetResourceOptions() const { return resource_options; } ModuleRequest* ModuleRequest::Cast(Data* data) { #ifdef V8_ENABLE_CHECKS CheckCast(data); #endif return reinterpret_cast<ModuleRequest*>(data); } Module* Module::Cast(Data* data) { #ifdef V8_ENABLE_CHECKS CheckCast(data); #endif return reinterpret_cast<Module*>(data); } } // namespace v8 #endif // INCLUDE_V8_SCRIPT_H_